C18H16F4O6S — CID 118048673
4-(4-butan-2-yl-2-methoxycarbonylphenoxy)-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 118048673) has the molecular formula C18H16F4O6S and a molecular weight of 436.38 g/mol. Its IUPAC name is 4-(4-butan-2-yl-2-methoxycarbonylphenoxy)-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-(4-butan-2-yl-2-methoxycarbonylphenoxy)-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 118048673 |
| Molecular Formula | C18H16F4O6S |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 4-(4-butan-2-yl-2-methoxycarbonylphenoxy)-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CCC(C)c1ccc(Oc2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)c(C(=O)OC)c1 |
| InChI | InChI=1S/C18H16F4O6S/c1-4-8(2)9-5-6-11(10(7-9)18(23)27-3)28-16-12(19)14(21)17(29(24,25)26)15(22)13(16)20/h5-8H,4H2,1-3H3,(H,24,25,26) |
| InChIKey | VQLFSXAGWZITHN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|