C16H10F8O4S2 — CID 118048680
4-(4-butan-2-yl-2,3,5,6-tetrafluorophenyl)sulfinyl-2,3,5,6-tetrafluorobenzenesulfonic acid (PubChem CID 118048680) has the molecular formula C16H10F8O4S2 and a molecular weight of 482.37 g/mol. Its IUPAC name is 4-(4-butan-2-yl-2,3,5,6-tetrafluorophenyl)sulfinyl-2,3,5,6-tetrafluorobenzenesulfonic acid.
| Compound Name | 4-(4-butan-2-yl-2,3,5,6-tetrafluorophenyl)sulfinyl-2,3,5,6-tetrafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 118048680 |
| Molecular Formula | C16H10F8O4S2 |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | 4-(4-butan-2-yl-2,3,5,6-tetrafluorophenyl)sulfinyl-2,3,5,6-tetrafluorobenzenesulfonic acid |
| SMILES | CCC(C)c1c(F)c(F)c(S(=O)c2c(F)c(F)c(S(=O)(=O)O)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C16H10F8O4S2/c1-3-4(2)5-6(17)8(19)14(9(20)7(5)18)29(25)15-10(21)12(23)16(30(26,27)28)13(24)11(15)22/h4H,3H2,1-2H3,(H,26,27,28) |
| InChIKey | SBOVFECDWAVRRT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|