About diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate
diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate (PubChem CID 118048837) has the molecular formula C11H16F2O5
and a molecular weight of 266.24 g/mol. Its IUPAC name is diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate.
Molecular Properties
| Compound Name | diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate |
| PubChem CID | 118048837 |
| Molecular Formula | C11H16F2O5 |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate |
| SMILES | CCOC(=O)/C=C(/OCC(C)(F)F)C(=O)OCC |
| InChI | InChI=1S/C11H16F2O5/c1-4-16-9(14)6-8(10(15)17-5-2)18-7-11(3,12)13/h6H,4-5,7H2,1-3H3/b8-6+ |
| InChIKey | DNKXWSQBVRHJMT-SOFGYWHQSA-N |
| XLogP | 1.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate?
The IUPAC name of diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate (CID 118048837) is diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate.
What is the SMILES notation for diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate?
The canonical SMILES for diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate is CCOC(=O)/C=C(/OCC(C)(F)F)C(=O)OCC.
What is the InChIKey of diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate?
The InChIKey is DNKXWSQBVRHJMT-SOFGYWHQSA-N. The full InChI is InChI=1S/C11H16F2O5/c1-4-16-9(14)6-8(10(15)17-5-2)18-7-11(3,12)13/h6H,4-5,7H2,1-3H3/b8-6+.
What are the key properties of diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate?
diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate has a molecular weight of 266.24 g/mol, XLogP of 1.67, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (E)-2-(2,2-difluoropropoxy)but-2-enedioate is sourced from PubChem (CID 118048837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).