C11H17NO3 — CID 118048956
methyl (1S,3R,4S)-3-methyl-4-(prop-2-enoylamino)cyclopentane-1-carboxylate (PubChem CID 118048956) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is methyl (1S,3R,4S)-3-methyl-4-(prop-2-enoylamino)cyclopentane-1-carboxylate.
| Compound Name | methyl (1S,3R,4S)-3-methyl-4-(prop-2-enoylamino)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 118048956 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | methyl (1S,3R,4S)-3-methyl-4-(prop-2-enoylamino)cyclopentane-1-carboxylate |
| SMILES | C=CC(=O)N[C@H]1C[C@@H](C(=O)OC)C[C@H]1C |
| InChI | InChI=1S/C11H17NO3/c1-4-10(13)12-9-6-8(5-7(9)2)11(14)15-3/h4,7-9H,1,5-6H2,2-3H3,(H,12,13)/t7-,8+,9+/m1/s1 |
| InChIKey | YHNJLIPRFRQTGJ-VGMNWLOBSA-N |
| XLogP | 0.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|