C24H26N6O2 — CID 118048998
3-(1,4-oxazepan-4-yl)prop-1-en-2-yl (4Z)-6-(1H-indol-4-yl)-1H-indazole-4-carbohydrazonate (PubChem CID 118048998) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3-(1,4-oxazepan-4-yl)prop-1-en-2-yl (4Z)-6-(1H-indol-4-yl)-1H-indazole-4-carbohydrazonate.
| Compound Name | 3-(1,4-oxazepan-4-yl)prop-1-en-2-yl (4Z)-6-(1H-indol-4-yl)-1H-indazole-4-carbohydrazonate |
|---|---|
| PubChem CID | 118048998 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 3-(1,4-oxazepan-4-yl)prop-1-en-2-yl (4Z)-6-(1H-indol-4-yl)-1H-indazole-4-carbohydrazonate |
| SMILES | C=C(CN1CCCOCC1)O/C(=N\N)c1cc(-c2cccc3[nH]ccc23)cc2[nH]ncc12 |
| InChI | InChI=1S/C24H26N6O2/c1-16(15-30-8-3-10-31-11-9-30)32-24(28-25)20-12-17(13-23-21(20)14-27-29-23)18-4-2-5-22-19(18)6-7-26-22/h2,4-7,12-14,26H,1,3,8-11,15,25H2,(H,27,29)/b28-24- |
| InChIKey | RQBWHEQTEXCRTO-COOPMVRXSA-N |
| XLogP | 3.58 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|