About 2-ethenoxyethyl methyl carbonate
2-ethenoxyethyl methyl carbonate (PubChem CID 11804902) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is 2-ethenoxyethyl methyl carbonate.
Molecular Properties
| Compound Name | 2-ethenoxyethyl methyl carbonate |
| PubChem CID | 11804902 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 2-ethenoxyethyl methyl carbonate |
| SMILES | C=COCCOC(=O)OC |
| InChI | InChI=1S/C6H10O4/c1-3-9-4-5-10-6(7)8-2/h3H,1,4-5H2,2H3 |
| InChIKey | GXEDVFPOHKBTFN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenoxyethyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenoxyethyl methyl carbonate?
The IUPAC name of 2-ethenoxyethyl methyl carbonate (CID 11804902) is 2-ethenoxyethyl methyl carbonate.
What is the SMILES notation for 2-ethenoxyethyl methyl carbonate?
The canonical SMILES for 2-ethenoxyethyl methyl carbonate is C=COCCOC(=O)OC.
What is the InChIKey of 2-ethenoxyethyl methyl carbonate?
The InChIKey is GXEDVFPOHKBTFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-3-9-4-5-10-6(7)8-2/h3H,1,4-5H2,2H3.
What are the key properties of 2-ethenoxyethyl methyl carbonate?
2-ethenoxyethyl methyl carbonate has a molecular weight of 146.14 g/mol, XLogP of 0.93, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenoxyethyl methyl carbonate is sourced from PubChem (CID 11804902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).