C9H18O2 — CID 118049120
trans-(3S,5S)-4,4,5-trimethylcyclohexane-1,3-diol (PubChem CID 118049120) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is trans-(3S,5S)-4,4,5-trimethylcyclohexane-1,3-diol.
| Compound Name | trans-(3S,5S)-4,4,5-trimethylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 118049120 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | trans-(3S,5S)-4,4,5-trimethylcyclohexane-1,3-diol |
| SMILES | C[C@H]1CC(O)C[C@H](O)C1(C)C |
| InChI | InChI=1S/C9H18O2/c1-6-4-7(10)5-8(11)9(6,2)3/h6-8,10-11H,4-5H2,1-3H3/t6-,7?,8-/m0/s1 |
| InChIKey | BAZXRXIUXJGLTL-PPSBICQBSA-N |
| XLogP | 1.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |