C7H12LiNO2 — CID 11804924
lithium (4S)-4-tert-butyl-1,3-oxazolidin-3-id-2-one (PubChem CID 11804924) has the molecular formula C7H12LiNO2 and a molecular weight of 149.12 g/mol. Its IUPAC name is lithium (4S)-4-tert-butyl-1,3-oxazolidin-3-id-2-one.
| Compound Name | lithium (4S)-4-tert-butyl-1,3-oxazolidin-3-id-2-one |
|---|---|
| PubChem CID | 11804924 |
| Molecular Formula | C7H12LiNO2 |
| Molecular Weight | 149.12 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | lithium (4S)-4-tert-butyl-1,3-oxazolidin-3-id-2-one |
| SMILES | CC(C)(C)[C@H]1COC(=O)[N-]1.[Li+] |
| InChI | InChI=1S/C7H13NO2.Li/c1-7(2,3)5-4-10-6(9)8-5;/h5H,4H2,1-3H3,(H,8,9);/q;+1/p-1/t5-;/m1./s1 |
| InChIKey | KEIWCMFLUHXLPR-NUBCRITNSA-M |
| XLogP | -1.07 |
| TPSA | 40.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.12 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |