About 5-fluoro-1,3-oxazolidin-2-one
5-fluoro-1,3-oxazolidin-2-one (PubChem CID 118049266) has the molecular formula C3H4FNO2
and a molecular weight of 105.07 g/mol. Its IUPAC name is 5-fluoro-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-fluoro-1,3-oxazolidin-2-one |
| PubChem CID | 118049266 |
| Molecular Formula | C3H4FNO2 |
| Molecular Weight | 105.07 g/mol |
| Exact Mass | 105.02 |
| IUPAC Name | 5-fluoro-1,3-oxazolidin-2-one |
| SMILES | O=C1NCC(F)O1 |
| InChI | InChI=1S/C3H4FNO2/c4-2-1-5-3(6)7-2/h2H,1H2,(H,5,6) |
| InChIKey | VREUERFGIKHXHR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.07 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,3-oxazolidin-2-one?
The IUPAC name of 5-fluoro-1,3-oxazolidin-2-one (CID 118049266) is 5-fluoro-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-fluoro-1,3-oxazolidin-2-one?
The canonical SMILES for 5-fluoro-1,3-oxazolidin-2-one is O=C1NCC(F)O1.
What is the InChIKey of 5-fluoro-1,3-oxazolidin-2-one?
The InChIKey is VREUERFGIKHXHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4FNO2/c4-2-1-5-3(6)7-2/h2H,1H2,(H,5,6).
What are the key properties of 5-fluoro-1,3-oxazolidin-2-one?
5-fluoro-1,3-oxazolidin-2-one has a molecular weight of 105.07 g/mol, XLogP of 0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,3-oxazolidin-2-one is sourced from PubChem (CID 118049266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).