ethyl 3,3-difluoro-2-methylprop-2-enoate

C6H8F2O2 — CID 11804932

IUPACethyl 3,3-difluoro-2-methylprop-2-enoate
SMILESCCOC(=O)C(C)=C(F)F
InChIInChI=1S/C6H8F2O2/c1-3-10-6(9)4(2)5(7)8/h3H2,1-2H3
InChIKeyMHBZAXRNBAOGHB-UHFFFAOYSA-N
MW150.12 g/mol
LogP1.72
Rot. Bonds2

About ethyl 3,3-difluoro-2-methylprop-2-enoate

ethyl 3,3-difluoro-2-methylprop-2-enoate (PubChem CID 11804932) has the molecular formula C6H8F2O2 and a molecular weight of 150.12 g/mol. Its IUPAC name is ethyl 3,3-difluoro-2-methylprop-2-enoate.

Molecular Properties

Compound Nameethyl 3,3-difluoro-2-methylprop-2-enoate
PubChem CID11804932
Molecular FormulaC6H8F2O2
Molecular Weight150.12 g/mol
Exact Mass150.05
IUPAC Nameethyl 3,3-difluoro-2-methylprop-2-enoate
SMILESCCOC(=O)C(C)=C(F)F
InChIInChI=1S/C6H8F2O2/c1-3-10-6(9)4(2)5(7)8/h3H2,1-2H3
InChIKeyMHBZAXRNBAOGHB-UHFFFAOYSA-N
XLogP1.72
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.12
LogP ≤ 51.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze ethyl 3,3-difluoro-2-methylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3,3-difluoro-2-methylprop-2-enoate?
The IUPAC name of ethyl 3,3-difluoro-2-methylprop-2-enoate (CID 11804932) is ethyl 3,3-difluoro-2-methylprop-2-enoate.
What is the SMILES notation for ethyl 3,3-difluoro-2-methylprop-2-enoate?
The canonical SMILES for ethyl 3,3-difluoro-2-methylprop-2-enoate is CCOC(=O)C(C)=C(F)F.
What is the InChIKey of ethyl 3,3-difluoro-2-methylprop-2-enoate?
The InChIKey is MHBZAXRNBAOGHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2O2/c1-3-10-6(9)4(2)5(7)8/h3H2,1-2H3.
What are the key properties of ethyl 3,3-difluoro-2-methylprop-2-enoate?
ethyl 3,3-difluoro-2-methylprop-2-enoate has a molecular weight of 150.12 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,3-difluoro-2-methylprop-2-enoate is sourced from PubChem (CID 11804932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).