C9H10O2 — CID 11804934
(1R,2R)-2-(furan-2-yl)cyclopent-3-en-1-ol (PubChem CID 11804934) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is (1R,2R)-2-(furan-2-yl)cyclopent-3-en-1-ol.
| Compound Name | (1R,2R)-2-(furan-2-yl)cyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 11804934 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | (1R,2R)-2-(furan-2-yl)cyclopent-3-en-1-ol |
| SMILES | O[C@@H]1CC=C[C@H]1c1ccco1 |
| InChI | InChI=1S/C9H10O2/c10-8-4-1-3-7(8)9-5-2-6-11-9/h1-3,5-8,10H,4H2/t7-,8-/m1/s1 |
| InChIKey | PUKWJRDEJYXGRE-HTQZYQBOSA-N |
| XLogP | 1.68 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|