C29H30N4O7S — CID 118049487
N-[2-[2-[(3,4-dihydroxybenzoyl)amino]ethyl-[2-[(2-methyl-1-benzothiophen-5-yl)amino]-2-oxoethyl]amino]ethyl]-3,4-dihydroxybenzamide (PubChem CID 118049487) has the molecular formula C29H30N4O7S and a molecular weight of 578.65 g/mol. Its IUPAC name is N-[2-[2-[(3,4-dihydroxybenzoyl)amino]ethyl-[2-[(2-methyl-1-benzothiophen-5-yl)amino]-2-oxoethyl]amino]ethyl]-3,4-dihydroxybenzamide.
| Compound Name | N-[2-[2-[(3,4-dihydroxybenzoyl)amino]ethyl-[2-[(2-methyl-1-benzothiophen-5-yl)amino]-2-oxoethyl]amino]ethyl]-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 118049487 |
| Molecular Formula | C29H30N4O7S |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | N-[2-[2-[(3,4-dihydroxybenzoyl)amino]ethyl-[2-[(2-methyl-1-benzothiophen-5-yl)amino]-2-oxoethyl]amino]ethyl]-3,4-dihydroxybenzamide |
| SMILES | Cc1cc2cc(NC(=O)CN(CCNC(=O)c3ccc(O)c(O)c3)CCNC(=O)c3ccc(O)c(O)c3)ccc2s1 |
| InChI | InChI=1S/C29H30N4O7S/c1-17-12-20-13-21(4-7-26(20)41-17)32-27(38)16-33(10-8-30-28(39)18-2-5-22(34)24(36)14-18)11-9-31-29(40)19-3-6-23(35)25(37)15-19/h2-7,12-15,34-37H,8-11,16H2,1H3,(H,30,39)(H,31,40)(H,32,38) |
| InChIKey | RKKKJYICFZUYJW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 171.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|