C11H12F6O5 — CID 118049661
diethyl (E)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)but-2-enedioate (PubChem CID 118049661) has the molecular formula C11H12F6O5 and a molecular weight of 338.20 g/mol. Its IUPAC name is diethyl (E)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)but-2-enedioate.
| Compound Name | diethyl (E)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)but-2-enedioate |
|---|---|
| PubChem CID | 118049661 |
| Molecular Formula | C11H12F6O5 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | diethyl (E)-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)but-2-enedioate |
| SMILES | CCOC(=O)/C=C(/OC(C(F)(F)F)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C11H12F6O5/c1-3-20-7(18)5-6(8(19)21-4-2)22-9(10(12,13)14)11(15,16)17/h5,9H,3-4H2,1-2H3/b6-5+ |
| InChIKey | IBOLVYGOKDVLJS-AATRIKPKSA-N |
| XLogP | 2.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|