C24H21N3O3 — CID 11805
1,3,5-tribenzyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 11805) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 1,3,5-tribenzyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tribenzyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 11805 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1,3,5-tribenzyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(Cc2ccccc2)c(=O)n(Cc2ccccc2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H21N3O3/c28-22-25(16-19-10-4-1-5-11-19)23(29)27(18-21-14-8-3-9-15-21)24(30)26(22)17-20-12-6-2-7-13-20/h1-15H,16-18H2 |
| InChIKey | PIBKGXNSYQOGKL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |