(1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid

C9H16O2 — CID 11805005

IUPAC(1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid
SMILESCC1(C)CCC[C@]1(C)C(=O)O
InChIInChI=1S/C9H16O2/c1-8(2)5-4-6-9(8,3)7(10)11/h4-6H2,1-3H3,(H,10,11)/t9-/m1/s1
InChIKeyRCRXFUAPDZIXLS-SECBINFHSA-N
MW156.22 g/mol
LogP2.29
Rot. Bonds1

About (1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid

(1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid (PubChem CID 11805005) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name(1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid
PubChem CID11805005
Molecular FormulaC9H16O2
Molecular Weight156.22 g/mol
Exact Mass156.12
IUPAC Name(1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid
SMILESCC1(C)CCC[C@]1(C)C(=O)O
InChIInChI=1S/C9H16O2/c1-8(2)5-4-6-9(8,3)7(10)11/h4-6H2,1-3H3,(H,10,11)/t9-/m1/s1
InChIKeyRCRXFUAPDZIXLS-SECBINFHSA-N
XLogP2.29
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.22
LogP ≤ 52.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid?
The IUPAC name of (1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid (CID 11805005) is (1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid.
What is the SMILES notation for (1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid?
The canonical SMILES for (1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid is CC1(C)CCC[C@]1(C)C(=O)O.
What is the InChIKey of (1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid?
The InChIKey is RCRXFUAPDZIXLS-SECBINFHSA-N. The full InChI is InChI=1S/C9H16O2/c1-8(2)5-4-6-9(8,3)7(10)11/h4-6H2,1-3H3,(H,10,11)/t9-/m1/s1.
What are the key properties of (1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid?
(1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid has a molecular weight of 156.22 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1,2,2-trimethylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 11805005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).