C33H38O10S — CID 118050226
[(2S)-3-[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-5-(2,2-dimethoxyethyl)-3-methoxyoxolan-2-yl]-2-benzoyloxypropyl] benzoate (PubChem CID 118050226) has the molecular formula C33H38O10S and a molecular weight of 626.72 g/mol. Its IUPAC name is [(2S)-3-[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-5-(2,2-dimethoxyethyl)-3-methoxyoxolan-2-yl]-2-benzoyloxypropyl] benzoate.
| Compound Name | [(2S)-3-[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-5-(2,2-dimethoxyethyl)-3-methoxyoxolan-2-yl]-2-benzoyloxypropyl] benzoate |
|---|---|
| PubChem CID | 118050226 |
| Molecular Formula | C33H38O10S |
| Molecular Weight | 626.72 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | [(2S)-3-[(2R,3R,4S,5S)-4-(benzenesulfonylmethyl)-5-(2,2-dimethoxyethyl)-3-methoxyoxolan-2-yl]-2-benzoyloxypropyl] benzoate |
| SMILES | COC(C[C@@H]1O[C@H](C[C@@H](COC(=O)c2ccccc2)OC(=O)c2ccccc2)[C@H](OC)[C@H]1CS(=O)(=O)c1ccccc1)OC |
| InChI | InChI=1S/C33H38O10S/c1-38-30(39-2)20-28-27(22-44(36,37)26-17-11-6-12-18-26)31(40-3)29(43-28)19-25(42-33(35)24-15-9-5-10-16-24)21-41-32(34)23-13-7-4-8-14-23/h4-18,25,27-31H,19-22H2,1-3H3/t25-,27-,28-,29+,31+/m0/s1 |
| InChIKey | WDMDDPIPMXXFRI-GTDTWWOTSA-N |
| XLogP | 4.34 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.72 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|