C20H27BrN2O7S — CID 118050471
(2R)-3-[3-(4-bromo-2-methylphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide (PubChem CID 118050471) has the molecular formula C20H27BrN2O7S and a molecular weight of 519.41 g/mol. Its IUPAC name is (2R)-3-[3-(4-bromo-2-methylphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide.
| Compound Name | (2R)-3-[3-(4-bromo-2-methylphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide |
|---|---|
| PubChem CID | 118050471 |
| Molecular Formula | C20H27BrN2O7S |
| Molecular Weight | 519.41 g/mol |
| Exact Mass | 518.07 |
| IUPAC Name | (2R)-3-[3-(4-bromo-2-methylphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide |
| SMILES | Cc1cc(Br)ccc1N1CC(C[C@](C)(C(=O)NOC2CCCCO2)S(C)(=O)=O)OC1=O |
| InChI | InChI=1S/C20H27BrN2O7S/c1-13-10-14(21)7-8-16(13)23-12-15(29-19(23)25)11-20(2,31(3,26)27)18(24)22-30-17-6-4-5-9-28-17/h7-8,10,15,17H,4-6,9,11-12H2,1-3H3,(H,22,24)/t15?,17?,20-/m1/s1 |
| InChIKey | CCRIJWVGSPECGN-MKJPBZQASA-N |
| XLogP | 2.85 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|