C21H20F3N5O2 — CID 118050572
N-[3-methoxy-4-(2-methyl-4-pyridinyl)phenyl]-8-(2,2,2-trifluoroethyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine (PubChem CID 118050572) has the molecular formula C21H20F3N5O2 and a molecular weight of 431.42 g/mol. Its IUPAC name is N-[3-methoxy-4-(2-methyl-4-pyridinyl)phenyl]-8-(2,2,2-trifluoroethyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine.
| Compound Name | N-[3-methoxy-4-(2-methyl-4-pyridinyl)phenyl]-8-(2,2,2-trifluoroethyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
|---|---|
| PubChem CID | 118050572 |
| Molecular Formula | C21H20F3N5O2 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[3-methoxy-4-(2-methyl-4-pyridinyl)phenyl]-8-(2,2,2-trifluoroethyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
| SMILES | COc1cc(Nc2ncc3c(n2)N(CC(F)(F)F)CCO3)ccc1-c1ccnc(C)c1 |
| InChI | InChI=1S/C21H20F3N5O2/c1-13-9-14(5-6-25-13)16-4-3-15(10-17(16)30-2)27-20-26-11-18-19(28-20)29(7-8-31-18)12-21(22,23)24/h3-6,9-11H,7-8,12H2,1-2H3,(H,26,27,28) |
| InChIKey | NUWICNGIYWYJHR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |