About 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine
6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine (PubChem CID 118050697) has the molecular formula C22H20N2OS2
and a molecular weight of 392.55 g/mol. Its IUPAC name is 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine |
| PubChem CID | 118050697 |
| Molecular Formula | C22H20N2OS2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine |
| SMILES | CCCCS(=O)c1cc2c(-c3ccccc3)nc(-c3ccccc3)nc2s1 |
| InChI | InChI=1S/C22H20N2OS2/c1-2-3-14-27(25)19-15-18-20(16-10-6-4-7-11-16)23-21(24-22(18)26-19)17-12-8-5-9-13-17/h4-13,15H,2-3,14H2,1H3 |
| InChIKey | AXPXWTSXSKWZDP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine?
The IUPAC name of 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine (CID 118050697) is 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine.
What is the SMILES notation for 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine?
The canonical SMILES for 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine is CCCCS(=O)c1cc2c(-c3ccccc3)nc(-c3ccccc3)nc2s1.
What is the InChIKey of 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine?
The InChIKey is AXPXWTSXSKWZDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2OS2/c1-2-3-14-27(25)19-15-18-20(16-10-6-4-7-11-16)23-21(24-22(18)26-19)17-12-8-5-9-13-17/h4-13,15H,2-3,14H2,1H3.
What are the key properties of 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine?
6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine has a molecular weight of 392.55 g/mol, XLogP of 5.93, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidine is sourced from PubChem (CID 118050697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).