C10H12O2 — CID 11805090
(2R,3R)-1,2,3,4-tetrahydronaphthalene-2,3-diol (PubChem CID 11805090) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (2R,3R)-1,2,3,4-tetrahydronaphthalene-2,3-diol.
| Compound Name | (2R,3R)-1,2,3,4-tetrahydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 11805090 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (2R,3R)-1,2,3,4-tetrahydronaphthalene-2,3-diol |
| SMILES | O[C@@H]1Cc2ccccc2C[C@H]1O |
| InChI | InChI=1S/C10H12O2/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-4,9-12H,5-6H2/t9-,10-/m1/s1 |
| InChIKey | DHTGPMXCRKCPTP-NXEZZACHSA-N |
| XLogP | 0.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |