C12H20 — CID 11805103
(2E,4E,6E)-5-ethyl-3-methylnona-2,4,6-triene (PubChem CID 11805103) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (2E,4E,6E)-5-ethyl-3-methylnona-2,4,6-triene.
| Compound Name | (2E,4E,6E)-5-ethyl-3-methylnona-2,4,6-triene |
|---|---|
| PubChem CID | 11805103 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (2E,4E,6E)-5-ethyl-3-methylnona-2,4,6-triene |
| SMILES | C/C=C(C)/C=C(/C=C/CC)CC |
| InChI | InChI=1S/C12H20/c1-5-8-9-12(7-3)10-11(4)6-2/h6,8-10H,5,7H2,1-4H3/b9-8+,11-6+,12-10+ |
| InChIKey | CCGOFOHHWSKWIK-GOZCNEPISA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|