About 3,4-diamino-2-nitrophenol
3,4-diamino-2-nitrophenol (PubChem CID 11805160) has the molecular formula C6H7N3O3
and a molecular weight of 169.14 g/mol. Its IUPAC name is 3,4-diamino-2-nitrophenol.
Molecular Properties
| Compound Name | 3,4-diamino-2-nitrophenol |
| PubChem CID | 11805160 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 3,4-diamino-2-nitrophenol |
| SMILES | Nc1ccc(O)c([N+](=O)[O-])c1N |
| InChI | InChI=1S/C6H7N3O3/c7-3-1-2-4(10)6(5(3)8)9(11)12/h1-2,10H,7-8H2 |
| InChIKey | KVRIRIIDYKCVCH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diamino-2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diamino-2-nitrophenol?
The IUPAC name of 3,4-diamino-2-nitrophenol (CID 11805160) is 3,4-diamino-2-nitrophenol.
What is the SMILES notation for 3,4-diamino-2-nitrophenol?
The canonical SMILES for 3,4-diamino-2-nitrophenol is Nc1ccc(O)c([N+](=O)[O-])c1N.
What is the InChIKey of 3,4-diamino-2-nitrophenol?
The InChIKey is KVRIRIIDYKCVCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O3/c7-3-1-2-4(10)6(5(3)8)9(11)12/h1-2,10H,7-8H2.
What are the key properties of 3,4-diamino-2-nitrophenol?
3,4-diamino-2-nitrophenol has a molecular weight of 169.14 g/mol, XLogP of 0.46, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diamino-2-nitrophenol is sourced from PubChem (CID 11805160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).