C9H9N3O3 — CID 118051711
(2-aminoimidazo[1,2-a]pyridin-6-yl) methyl carbonate (PubChem CID 118051711) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is (2-aminoimidazo[1,2-a]pyridin-6-yl) methyl carbonate.
| Compound Name | (2-aminoimidazo[1,2-a]pyridin-6-yl) methyl carbonate |
|---|---|
| PubChem CID | 118051711 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | (2-aminoimidazo[1,2-a]pyridin-6-yl) methyl carbonate |
| SMILES | COC(=O)Oc1ccc2nc(N)cn2c1 |
| InChI | InChI=1S/C9H9N3O3/c1-14-9(13)15-6-2-3-8-11-7(10)5-12(8)4-6/h2-5H,10H2,1H3 |
| InChIKey | HSSGZFXWFRSBCB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |