C60H32N6 — CID 118051776
3,5-bis(benzo[c]carbazol-7-yl)-2,4,6-tris(4-cyanophenyl)benzonitrile (PubChem CID 118051776) has the molecular formula C60H32N6 and a molecular weight of 836.96 g/mol. Its IUPAC name is 3,5-bis(benzo[c]carbazol-7-yl)-2,4,6-tris(4-cyanophenyl)benzonitrile.
| Compound Name | 3,5-bis(benzo[c]carbazol-7-yl)-2,4,6-tris(4-cyanophenyl)benzonitrile |
|---|---|
| PubChem CID | 118051776 |
| Molecular Formula | C60H32N6 |
| Molecular Weight | 836.96 g/mol |
| Exact Mass | 836.27 |
| IUPAC Name | 3,5-bis(benzo[c]carbazol-7-yl)-2,4,6-tris(4-cyanophenyl)benzonitrile |
| SMILES | N#Cc1ccc(-c2c(C#N)c(-c3ccc(C#N)cc3)c(-n3c4ccccc4c4c5ccccc5ccc43)c(-c3ccc(C#N)cc3)c2-n2c3ccccc3c3c4ccccc4ccc32)cc1 |
| InChI | InChI=1S/C60H32N6/c61-33-37-17-23-42(24-18-37)54-49(36-64)55(43-25-19-38(34-62)20-26-43)60(66-51-16-8-6-14-48(51)58-46-12-4-2-10-41(46)30-32-53(58)66)56(44-27-21-39(35-63)22-28-44)59(54)65-50-15-7-5-13-47(50)57-45-11-3-1-9-40(45)29-31-52(57)65/h1-32H |
| InChIKey | SBEINTFGGXRMCT-UHFFFAOYSA-N |
| XLogP | 14.67 |
| TPSA | 105.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.96 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |