C19H19F3N6O2 — CID 118051925
N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-8-(2,2,2-trifluoroethyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine (PubChem CID 118051925) has the molecular formula C19H19F3N6O2 and a molecular weight of 420.40 g/mol. Its IUPAC name is N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-8-(2,2,2-trifluoroethyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine.
| Compound Name | N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-8-(2,2,2-trifluoroethyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
|---|---|
| PubChem CID | 118051925 |
| Molecular Formula | C19H19F3N6O2 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-8-(2,2,2-trifluoroethyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
| SMILES | COc1cc(Nc2ncc3c(n2)N(CC(F)(F)F)CCO3)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C19H19F3N6O2/c1-12-9-28(11-24-12)14-4-3-13(7-15(14)29-2)25-18-23-8-16-17(26-18)27(5-6-30-16)10-19(20,21)22/h3-4,7-9,11H,5-6,10H2,1-2H3,(H,23,25,26) |
| InChIKey | MMKFXFHSBXLOBQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |