About ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate
ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate (PubChem CID 11805210) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate |
| PubChem CID | 11805210 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate |
| SMILES | CCOC(=O)c1nc(C)ns1 |
| InChI | InChI=1S/C6H8N2O2S/c1-3-10-6(9)5-7-4(2)8-11-5/h3H2,1-2H3 |
| InChIKey | ZYVYMUYJEAVYOC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate?
The IUPAC name of ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate (CID 11805210) is ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate.
What is the SMILES notation for ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate?
The canonical SMILES for ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate is CCOC(=O)c1nc(C)ns1.
What is the InChIKey of ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate?
The InChIKey is ZYVYMUYJEAVYOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-3-10-6(9)5-7-4(2)8-11-5/h3H2,1-2H3.
What are the key properties of ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate?
ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate has a molecular weight of 172.21 g/mol, XLogP of 1.02, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methyl-1,2,4-thiadiazole-5-carboxylate is sourced from PubChem (CID 11805210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).