About 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane
1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane (PubChem CID 11805223) has the molecular formula C13H16
and a molecular weight of 172.27 g/mol. Its IUPAC name is 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane.
Molecular Properties
| Compound Name | 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane |
| PubChem CID | 11805223 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane |
| SMILES | C#CC(C#C)=C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H16/c1-5-11(6-2)12-7-9-13(3,4)10-8-12/h1-2H,7-10H2,3-4H3 |
| InChIKey | UQVQMGVLSACEFF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane?
The IUPAC name of 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane (CID 11805223) is 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane.
What is the SMILES notation for 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane?
The canonical SMILES for 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane is C#CC(C#C)=C1CCC(C)(C)CC1.
What is the InChIKey of 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane?
The InChIKey is UQVQMGVLSACEFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16/c1-5-11(6-2)12-7-9-13(3,4)10-8-12/h1-2H,7-10H2,3-4H3.
What are the key properties of 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane?
1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane has a molecular weight of 172.27 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-4-penta-1,4-diyn-3-ylidenecyclohexane is sourced from PubChem (CID 11805223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).