C19H28N8O10S4 — CID 118052310
2-[[4,6-bis(4-methylsulfonylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid (PubChem CID 118052310) has the molecular formula C19H28N8O10S4 and a molecular weight of 656.75 g/mol. Its IUPAC name is 2-[[4,6-bis(4-methylsulfonylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[4,6-bis(4-methylsulfonylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 118052310 |
| Molecular Formula | C19H28N8O10S4 |
| Molecular Weight | 656.75 g/mol |
| Exact Mass | 656.08 |
| IUPAC Name | 2-[[4,6-bis(4-methylsulfonylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
| SMILES | CS(=O)(=O)N1CCN(c2nc(Nc3cc(S(=O)(=O)O)ccc3S(=O)(=O)O)nc(N3CCN(S(C)(=O)=O)CC3)n2)CC1 |
| InChI | InChI=1S/C19H28N8O10S4/c1-38(28,29)26-9-5-24(6-10-26)18-21-17(22-19(23-18)25-7-11-27(12-8-25)39(2,30)31)20-15-13-14(40(32,33)34)3-4-16(15)41(35,36)37/h3-4,13H,5-12H2,1-2H3,(H,32,33,34)(H,35,36,37)(H,20,21,22,23) |
| InChIKey | REGYJGZYRQHZCR-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 240.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.75 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|