About 2-phenylsulfanylfuran
2-phenylsulfanylfuran (PubChem CID 11805267) has the molecular formula C10H8OS
and a molecular weight of 176.24 g/mol. Its IUPAC name is 2-phenylsulfanylfuran.
Molecular Properties
| Compound Name | 2-phenylsulfanylfuran |
| PubChem CID | 11805267 |
| Molecular Formula | C10H8OS |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 2-phenylsulfanylfuran |
| SMILES | c1ccc(Sc2ccco2)cc1 |
| InChI | InChI=1S/C10H8OS/c1-2-5-9(6-3-1)12-10-7-4-8-11-10/h1-8H |
| InChIKey | KOLRDJDHOMTWFK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylsulfanylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylfuran?
The IUPAC name of 2-phenylsulfanylfuran (CID 11805267) is 2-phenylsulfanylfuran.
What is the SMILES notation for 2-phenylsulfanylfuran?
The canonical SMILES for 2-phenylsulfanylfuran is c1ccc(Sc2ccco2)cc1.
What is the InChIKey of 2-phenylsulfanylfuran?
The InChIKey is KOLRDJDHOMTWFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8OS/c1-2-5-9(6-3-1)12-10-7-4-8-11-10/h1-8H.
What are the key properties of 2-phenylsulfanylfuran?
2-phenylsulfanylfuran has a molecular weight of 176.24 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylfuran is sourced from PubChem (CID 11805267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).