C26H21NO3 — CID 118052801
1,6-dimethyl-2-[(N-methylanilino)methyl]naphtho[1,2-g][1]benzofuran-10,11-dione (PubChem CID 118052801) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1,6-dimethyl-2-[(N-methylanilino)methyl]naphtho[1,2-g][1]benzofuran-10,11-dione.
| Compound Name | 1,6-dimethyl-2-[(N-methylanilino)methyl]naphtho[1,2-g][1]benzofuran-10,11-dione |
|---|---|
| PubChem CID | 118052801 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 1,6-dimethyl-2-[(N-methylanilino)methyl]naphtho[1,2-g][1]benzofuran-10,11-dione |
| SMILES | Cc1c(CN(C)c2ccccc2)oc2c1C(=O)C(=O)c1c-2ccc2c(C)cccc12 |
| InChI | InChI=1S/C26H21NO3/c1-15-8-7-11-19-18(15)12-13-20-23(19)25(29)24(28)22-16(2)21(30-26(20)22)14-27(3)17-9-5-4-6-10-17/h4-13H,14H2,1-3H3 |
| InChIKey | GITJKRGGXTTWFQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|