C30H34N2O6 — CID 118052813
2-[(1,6-dimethyl-10,11-dioxonaphtho[1,2-g][1]benzofuran-2-yl)methyl-methylamino]ethyl 2-(3,3-dimethylbutanoylamino)acetate (PubChem CID 118052813) has the molecular formula C30H34N2O6 and a molecular weight of 518.61 g/mol. Its IUPAC name is 2-[(1,6-dimethyl-10,11-dioxonaphtho[1,2-g][1]benzofuran-2-yl)methyl-methylamino]ethyl 2-(3,3-dimethylbutanoylamino)acetate.
| Compound Name | 2-[(1,6-dimethyl-10,11-dioxonaphtho[1,2-g][1]benzofuran-2-yl)methyl-methylamino]ethyl 2-(3,3-dimethylbutanoylamino)acetate |
|---|---|
| PubChem CID | 118052813 |
| Molecular Formula | C30H34N2O6 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 2-[(1,6-dimethyl-10,11-dioxonaphtho[1,2-g][1]benzofuran-2-yl)methyl-methylamino]ethyl 2-(3,3-dimethylbutanoylamino)acetate |
| SMILES | Cc1c(CN(C)CCOC(=O)CNC(=O)CC(C)(C)C)oc2c1C(=O)C(=O)c1c-2ccc2c(C)cccc12 |
| InChI | InChI=1S/C30H34N2O6/c1-17-8-7-9-20-19(17)10-11-21-26(20)28(36)27(35)25-18(2)22(38-29(21)25)16-32(6)12-13-37-24(34)15-31-23(33)14-30(3,4)5/h7-11H,12-16H2,1-6H3,(H,31,33) |
| InChIKey | QLDJEKAHHLHZHZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|