C8H7NO4 — CID 11805363
(1R,2S,7R,8S)-5,11-dioxa-3-azatricyclo[6.2.1.02,7]undec-9-ene-4,6-dione (PubChem CID 11805363) has the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. Its IUPAC name is (1R,2S,7R,8S)-5,11-dioxa-3-azatricyclo[6.2.1.02,7]undec-9-ene-4,6-dione.
| Compound Name | (1R,2S,7R,8S)-5,11-dioxa-3-azatricyclo[6.2.1.02,7]undec-9-ene-4,6-dione |
|---|---|
| PubChem CID | 11805363 |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | (1R,2S,7R,8S)-5,11-dioxa-3-azatricyclo[6.2.1.02,7]undec-9-ene-4,6-dione |
| SMILES | O=C1N[C@H]2[C@@H](C(=O)O1)[C@@H]1C=C[C@H]2O1 |
| InChI | InChI=1S/C8H7NO4/c10-7-5-3-1-2-4(12-3)6(5)9-8(11)13-7/h1-6H,(H,9,11)/t3-,4+,5-,6+/m0/s1 |
| InChIKey | LVZMCWCHHXWCBQ-BGPJRJDNSA-N |
| XLogP | -0.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|