C27H50F2O7 — CID 118053820
ethyl 2,2-difluoro-2-[(2R,3R,4S,5S,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-methyloxan-2-yl]acetate (PubChem CID 118053820) has the molecular formula C27H50F2O7 and a molecular weight of 524.69 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-[(2R,3R,4S,5S,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-methyloxan-2-yl]acetate.
| Compound Name | ethyl 2,2-difluoro-2-[(2R,3R,4S,5S,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 118053820 |
| Molecular Formula | C27H50F2O7 |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | ethyl 2,2-difluoro-2-[(2R,3R,4S,5S,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-methyloxan-2-yl]acetate |
| SMILES | CCCCOC[C@H]1O[C@@](C)(C(F)(F)C(=O)OCC)[C@H](OCCCC)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C27H50F2O7/c1-7-12-16-31-20-21-22(33-17-13-8-2)23(34-18-14-9-3)24(35-19-15-10-4)26(6,36-21)27(28,29)25(30)32-11-5/h21-24H,7-20H2,1-6H3/t21-,22+,23+,24-,26-/m1/s1 |
| InChIKey | HQLZMNXBONDWRQ-IUSCBXDMSA-N |
| XLogP | 5.71 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|