C17H15ClN4O — CID 118053894
(1S,5S)-2-(2-chloro-4-pyridinyl)-4-(4-cyclopropyl-3-pyridinyl)-2,4-diazabicyclo[3.1.0]hexan-3-one (PubChem CID 118053894) has the molecular formula C17H15ClN4O and a molecular weight of 326.79 g/mol. Its IUPAC name is (1S,5S)-2-(2-chloro-4-pyridinyl)-4-(4-cyclopropyl-3-pyridinyl)-2,4-diazabicyclo[3.1.0]hexan-3-one.
| Compound Name | (1S,5S)-2-(2-chloro-4-pyridinyl)-4-(4-cyclopropyl-3-pyridinyl)-2,4-diazabicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 118053894 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (1S,5S)-2-(2-chloro-4-pyridinyl)-4-(4-cyclopropyl-3-pyridinyl)-2,4-diazabicyclo[3.1.0]hexan-3-one |
| SMILES | O=C1N(c2ccnc(Cl)c2)[C@H]2C[C@@H]2N1c1cnccc1C1CC1 |
| InChI | InChI=1S/C17H15ClN4O/c18-16-7-11(3-6-20-16)21-13-8-14(13)22(17(21)23)15-9-19-5-4-12(15)10-1-2-10/h3-7,9-10,13-14H,1-2,8H2/t13-,14-/m0/s1 |
| InChIKey | ZOISWEGQAUQFGF-KBPBESRZSA-N |
| XLogP | 3.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|