C22H28FN6O8P — CID 118054049
(2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid (PubChem CID 118054049) has the molecular formula C22H28FN6O8P and a molecular weight of 554.47 g/mol. Its IUPAC name is (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid.
| Compound Name | (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 118054049 |
| Molecular Formula | C22H28FN6O8P |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO[P@@](=O)(N[C@H](C)C(=O)O)Oc2ccccc2)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C22H28FN6O8P/c1-4-34-18-15-17(26-21(24)27-18)29(11-25-15)20-22(3,23)16(30)14(36-20)10-35-38(33,28-12(2)19(31)32)37-13-8-6-5-7-9-13/h5-9,11-12,14,16,20,30H,4,10H2,1-3H3,(H,28,33)(H,31,32)(H2,24,26,27)/t12-,14-,16-,20-,22-,38+/m1/s1 |
| InChIKey | NCVYAEDIMSBVQX-DYRRXRMPSA-N |
| XLogP | 2.06 |
| TPSA | 193.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|