About 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one
5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one (PubChem CID 118054247) has the molecular formula C9H9BrO2
and a molecular weight of 229.07 g/mol. Its IUPAC name is 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one |
| PubChem CID | 118054247 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one |
| SMILES | CC1=C2C(=O)OCC2CC(Br)=C1 |
| InChI | InChI=1S/C9H9BrO2/c1-5-2-7(10)3-6-4-12-9(11)8(5)6/h2,6H,3-4H2,1H3 |
| InChIKey | SAZNNMGWTYDAFJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one?
The IUPAC name of 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one (CID 118054247) is 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one.
What is the SMILES notation for 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one?
The canonical SMILES for 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one is CC1=C2C(=O)OCC2CC(Br)=C1.
What is the InChIKey of 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one?
The InChIKey is SAZNNMGWTYDAFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO2/c1-5-2-7(10)3-6-4-12-9(11)8(5)6/h2,6H,3-4H2,1H3.
What are the key properties of 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one?
5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one has a molecular weight of 229.07 g/mol, XLogP of 2.16, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-7-methyl-3a,4-dihydro-3H-2-benzofuran-1-one is sourced from PubChem (CID 118054247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).