C21H28O2S2 — CID 118054391
2-[(E)-4-(1,4-dimethoxy-3-methyl-6,7-dihydronaphthalen-2-yl)but-2-en-2-yl]-1,3-dithiane (PubChem CID 118054391) has the molecular formula C21H28O2S2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 2-[(E)-4-(1,4-dimethoxy-3-methyl-6,7-dihydronaphthalen-2-yl)but-2-en-2-yl]-1,3-dithiane.
| Compound Name | 2-[(E)-4-(1,4-dimethoxy-3-methyl-6,7-dihydronaphthalen-2-yl)but-2-en-2-yl]-1,3-dithiane |
|---|---|
| PubChem CID | 118054391 |
| Molecular Formula | C21H28O2S2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[(E)-4-(1,4-dimethoxy-3-methyl-6,7-dihydronaphthalen-2-yl)but-2-en-2-yl]-1,3-dithiane |
| SMILES | COc1c(C)c(C/C=C(\C)C2SCCCS2)c(OC)c2c1=CCCC=2 |
| InChI | InChI=1S/C21H28O2S2/c1-14(21-24-12-7-13-25-21)10-11-16-15(2)19(22-3)17-8-5-6-9-18(17)20(16)23-4/h8-10,21H,5-7,11-13H2,1-4H3/b14-10+ |
| InChIKey | LVCXGNXAETZWEM-GXDHUFHOSA-N |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|