C13H17BrFNO3 — CID 118054562
tert-butyl N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-hydroxyethyl]carbamate (PubChem CID 118054562) has the molecular formula C13H17BrFNO3 and a molecular weight of 334.19 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-hydroxyethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 118054562 |
| Molecular Formula | C13H17BrFNO3 |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | tert-butyl N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-hydroxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C13H17BrFNO3/c1-13(2,3)19-12(18)16-11(7-17)8-4-9(14)6-10(15)5-8/h4-6,11,17H,7H2,1-3H3,(H,16,18)/t11-/m1/s1 |
| InChIKey | HGLSSZBRIYUHFT-LLVKDONJSA-N |
| XLogP | 3.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |