About tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate
tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate (PubChem CID 118054602) has the molecular formula C21H23F2N3O3
and a molecular weight of 403.43 g/mol. Its IUPAC name is tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate.
Molecular Properties
| Compound Name | tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate |
| PubChem CID | 118054602 |
| Molecular Formula | C21H23F2N3O3 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2nc([C@@H]3CCC(=O)[C@@H](F)C3)cnc2N)cc1F |
| InChI | InChI=1S/C21H23F2N3O3/c1-21(2,3)29-20(28)13-6-4-12(9-14(13)22)18-19(24)25-10-16(26-18)11-5-7-17(27)15(23)8-11/h4,6,9-11,15H,5,7-8H2,1-3H3,(H2,24,25)/t11-,15+/m1/s1 |
| InChIKey | SCWVPDYJLKMRMN-ABAIWWIYSA-N |
| XLogP | 3.99 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate?
The IUPAC name of tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate (CID 118054602) is tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate.
What is the SMILES notation for tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate?
The canonical SMILES for tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate is CC(C)(C)OC(=O)c1ccc(-c2nc([C@@H]3CCC(=O)[C@@H](F)C3)cnc2N)cc1F.
What is the InChIKey of tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate?
The InChIKey is SCWVPDYJLKMRMN-ABAIWWIYSA-N. The full InChI is InChI=1S/C21H23F2N3O3/c1-21(2,3)29-20(28)13-6-4-12(9-14(13)22)18-19(24)25-10-16(26-18)11-5-7-17(27)15(23)8-11/h4,6,9-11,15H,5,7-8H2,1-3H3,(H2,24,25)/t11-,15+/m1/s1.
What are the key properties of tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate?
tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate has a molecular weight of 403.43 g/mol, XLogP of 3.99, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[3-amino-6-[(1R,3S)-3-fluoro-4-oxocyclohexyl]pyrazin-2-yl]-2-fluorobenzoate is sourced from PubChem (CID 118054602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).