C9H16O4 — CID 11805484
[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol (PubChem CID 11805484) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol.
| Compound Name | [(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol |
|---|---|
| PubChem CID | 11805484 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | [(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methanol |
| SMILES | C[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1CO |
| InChI | InChI=1S/C9H16O4/c1-5-6(4-10)11-8-7(5)12-9(2,3)13-8/h5-8,10H,4H2,1-3H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | QSFFQPSPYRVHMA-WCTZXXKLSA-N |
| XLogP | 0.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |