C9H11N5O2 — CID 118054894
N,N-dimethyl-1-(6-nitro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanamine (PubChem CID 118054894) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is N,N-dimethyl-1-(6-nitro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(6-nitro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanamine |
|---|---|
| PubChem CID | 118054894 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | N,N-dimethyl-1-(6-nitro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanamine |
| SMILES | CN(C)Cc1nnc2ccc([N+](=O)[O-])cn12 |
| InChI | InChI=1S/C9H11N5O2/c1-12(2)6-9-11-10-8-4-3-7(14(15)16)5-13(8)9/h3-5H,6H2,1-2H3 |
| InChIKey | ZDNGJYLOAKLOCN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|