C23H25ClN6O — CID 118055017
N-[1-(2-chloro-4-pyridinyl)piperidin-4-yl]-8-(2-methylphenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine (PubChem CID 118055017) has the molecular formula C23H25ClN6O and a molecular weight of 436.95 g/mol. Its IUPAC name is N-[1-(2-chloro-4-pyridinyl)piperidin-4-yl]-8-(2-methylphenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine.
| Compound Name | N-[1-(2-chloro-4-pyridinyl)piperidin-4-yl]-8-(2-methylphenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
|---|---|
| PubChem CID | 118055017 |
| Molecular Formula | C23H25ClN6O |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-[1-(2-chloro-4-pyridinyl)piperidin-4-yl]-8-(2-methylphenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
| SMILES | Cc1ccccc1N1CCOc2cnc(NC3CCN(c4ccnc(Cl)c4)CC3)nc21 |
| InChI | InChI=1S/C23H25ClN6O/c1-16-4-2-3-5-19(16)30-12-13-31-20-15-26-23(28-22(20)30)27-17-7-10-29(11-8-17)18-6-9-25-21(24)14-18/h2-6,9,14-15,17H,7-8,10-13H2,1H3,(H,26,27,28) |
| InChIKey | YZZHGHAMABZSAP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|