C13H18N2 — CID 118055318
(2R,3R)-2,3-dimethyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene (PubChem CID 118055318) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (2R,3R)-2,3-dimethyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene.
| Compound Name | (2R,3R)-2,3-dimethyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene |
|---|---|
| PubChem CID | 118055318 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (2R,3R)-2,3-dimethyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene |
| SMILES | C[C@@H]1c2cccc3c2N(CCNC3)[C@@H]1C |
| InChI | InChI=1S/C13H18N2/c1-9-10(2)15-7-6-14-8-11-4-3-5-12(9)13(11)15/h3-5,9-10,14H,6-8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | FNXSPNNLGYRBKE-VHSXEESVSA-N |
| XLogP | 2.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |