C14H22 — CID 11805533
(1'R,2'R,4'S,5'S)-2',4'-dimethylspiro[cyclopentane-1,3'-tricyclo[3.3.0.02,4]octane] (PubChem CID 11805533) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (1'R,2'R,4'S,5'S)-2',4'-dimethylspiro[cyclopentane-1,3'-tricyclo[3.3.0.02,4]octane].
| Compound Name | (1'R,2'R,4'S,5'S)-2',4'-dimethylspiro[cyclopentane-1,3'-tricyclo[3.3.0.02,4]octane] |
|---|---|
| PubChem CID | 11805533 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (1'R,2'R,4'S,5'S)-2',4'-dimethylspiro[cyclopentane-1,3'-tricyclo[3.3.0.02,4]octane] |
| SMILES | C[C@@]12[C@H]3CCC[C@H]3[C@]1(C)C21CCCC1 |
| InChI | InChI=1S/C14H22/c1-12-10-6-5-7-11(10)13(12,2)14(12)8-3-4-9-14/h10-11H,3-9H2,1-2H3/t10-,11+,12+,13- |
| InChIKey | FPYJUSONWUSCNV-FNFFVJSTSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |