C10H13NOS — CID 11805628
7-methoxy-2,3,4,5-tetrahydro-1,4-benzothiazepine (PubChem CID 11805628) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 7-methoxy-2,3,4,5-tetrahydro-1,4-benzothiazepine.
| Compound Name | 7-methoxy-2,3,4,5-tetrahydro-1,4-benzothiazepine |
|---|---|
| PubChem CID | 11805628 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 7-methoxy-2,3,4,5-tetrahydro-1,4-benzothiazepine |
| SMILES | COc1ccc2c(c1)CNCCS2 |
| InChI | InChI=1S/C10H13NOS/c1-12-9-2-3-10-8(6-9)7-11-4-5-13-10/h2-3,6,11H,4-5,7H2,1H3 |
| InChIKey | VXSSDKLUAZVADY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |