C29H28F2N8O4 — CID 118056409
1-[4-[1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-3-(6-methoxypyridazin-3-yl)-2,4-dioxopyrrolo[2,1-f][1,2,4]triazin-6-yl]phenyl]-3-methylurea (PubChem CID 118056409) has the molecular formula C29H28F2N8O4 and a molecular weight of 590.59 g/mol. Its IUPAC name is 1-[4-[1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-3-(6-methoxypyridazin-3-yl)-2,4-dioxopyrrolo[2,1-f][1,2,4]triazin-6-yl]phenyl]-3-methylurea.
| Compound Name | 1-[4-[1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-3-(6-methoxypyridazin-3-yl)-2,4-dioxopyrrolo[2,1-f][1,2,4]triazin-6-yl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 118056409 |
| Molecular Formula | C29H28F2N8O4 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 1-[4-[1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-3-(6-methoxypyridazin-3-yl)-2,4-dioxopyrrolo[2,1-f][1,2,4]triazin-6-yl]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(-c2cn3c(c2CN(C)C)c(=O)n(-c2ccc(OC)nn2)c(=O)n3Cc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C29H28F2N8O4/c1-32-28(41)33-18-10-8-17(9-11-18)19-15-37-26(20(19)14-36(2)3)27(40)39(24-12-13-25(43-4)35-34-24)29(42)38(37)16-21-22(30)6-5-7-23(21)31/h5-13,15H,14,16H2,1-4H3,(H2,32,33,41) |
| InChIKey | UAJGABKTNQOVEW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |