C27H42O11 — CID 118056757
[(2R)-2-acetyloxy-3-[5-[(S)-acetyloxy-[(2R,6S)-6-methyl-3-oxo-6-prop-2-enyloxan-2-yl]methyl]-3-butoxy-4-hydroxyoxolan-2-yl]propyl] acetate (PubChem CID 118056757) has the molecular formula C27H42O11 and a molecular weight of 542.62 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-[5-[(S)-acetyloxy-[(2R,6S)-6-methyl-3-oxo-6-prop-2-enyloxan-2-yl]methyl]-3-butoxy-4-hydroxyoxolan-2-yl]propyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-3-[5-[(S)-acetyloxy-[(2R,6S)-6-methyl-3-oxo-6-prop-2-enyloxan-2-yl]methyl]-3-butoxy-4-hydroxyoxolan-2-yl]propyl] acetate |
|---|---|
| PubChem CID | 118056757 |
| Molecular Formula | C27H42O11 |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | [(2R)-2-acetyloxy-3-[5-[(S)-acetyloxy-[(2R,6S)-6-methyl-3-oxo-6-prop-2-enyloxan-2-yl]methyl]-3-butoxy-4-hydroxyoxolan-2-yl]propyl] acetate |
| SMILES | C=CC[C@]1(C)CCC(=O)[C@@H]([C@@H](OC(C)=O)C2OC(C[C@H](COC(C)=O)OC(C)=O)C(OCCCC)C2O)O1 |
| InChI | InChI=1S/C27H42O11/c1-7-9-13-33-24-21(14-19(35-17(4)29)15-34-16(3)28)37-25(22(24)32)26(36-18(5)30)23-20(31)10-12-27(6,38-23)11-8-2/h8,19,21-26,32H,2,7,9-15H2,1,3-6H3/t19-,21?,22?,23+,24?,25?,26-,27-/m1/s1 |
| InChIKey | KDXRHJPGTZAMMO-IPWXEDOXSA-N |
| XLogP | 2.20 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|