C21H21F2N3O — CID 118056900
azetidin-1-yl-[(2S,5S)-9-(2,6-difluorophenyl)-11-methyl-7,8-diazatricyclo[4.4.1.12,5]dodeca-1(11),7,9-trien-5-yl]methanone (PubChem CID 118056900) has the molecular formula C21H21F2N3O and a molecular weight of 369.42 g/mol. Its IUPAC name is azetidin-1-yl-[(2S,5S)-9-(2,6-difluorophenyl)-11-methyl-7,8-diazatricyclo[4.4.1.12,5]dodeca-1(11),7,9-trien-5-yl]methanone.
| Compound Name | azetidin-1-yl-[(2S,5S)-9-(2,6-difluorophenyl)-11-methyl-7,8-diazatricyclo[4.4.1.12,5]dodeca-1(11),7,9-trien-5-yl]methanone |
|---|---|
| PubChem CID | 118056900 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | azetidin-1-yl-[(2S,5S)-9-(2,6-difluorophenyl)-11-methyl-7,8-diazatricyclo[4.4.1.12,5]dodeca-1(11),7,9-trien-5-yl]methanone |
| SMILES | CC1=C2C=C(c3c(F)cccc3F)N=NC1[C@]1(C(=O)N3CCC3)CC[C@H]2C1 |
| InChI | InChI=1S/C21H21F2N3O/c1-12-14-10-17(18-15(22)4-2-5-16(18)23)24-25-19(12)21(7-6-13(14)11-21)20(27)26-8-3-9-26/h2,4-5,10,13,19H,3,6-9,11H2,1H3/t13-,19?,21-/m0/s1 |
| InChIKey | SOYWUTYKTGZBHR-CRWSDSFCSA-N |
| XLogP | 4.49 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |