C21H20F3N3O — CID 118056932
[(2S,5S)-9-(2,6-difluorophenyl)-11-methyl-7,8-diazatricyclo[4.4.1.12,5]dodeca-1(11),7,9-trien-5-yl]-(3-fluoroazetidin-1-yl)methanone (PubChem CID 118056932) has the molecular formula C21H20F3N3O and a molecular weight of 387.41 g/mol. Its IUPAC name is [(2S,5S)-9-(2,6-difluorophenyl)-11-methyl-7,8-diazatricyclo[4.4.1.12,5]dodeca-1(11),7,9-trien-5-yl]-(3-fluoroazetidin-1-yl)methanone.
| Compound Name | [(2S,5S)-9-(2,6-difluorophenyl)-11-methyl-7,8-diazatricyclo[4.4.1.12,5]dodeca-1(11),7,9-trien-5-yl]-(3-fluoroazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 118056932 |
| Molecular Formula | C21H20F3N3O |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | [(2S,5S)-9-(2,6-difluorophenyl)-11-methyl-7,8-diazatricyclo[4.4.1.12,5]dodeca-1(11),7,9-trien-5-yl]-(3-fluoroazetidin-1-yl)methanone |
| SMILES | CC1=C2C=C(c3c(F)cccc3F)N=NC1[C@]1(C(=O)N3CC(F)C3)CC[C@H]2C1 |
| InChI | InChI=1S/C21H20F3N3O/c1-11-14-7-17(18-15(23)3-2-4-16(18)24)25-26-19(11)21(6-5-12(14)8-21)20(28)27-9-13(22)10-27/h2-4,7,12-13,19H,5-6,8-10H2,1H3/t12-,19?,21-/m0/s1 |
| InChIKey | NMLSBILPIPBBSI-DYYNJQRZSA-N |
| XLogP | 4.44 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |