C24H30F5N3O2S — CID 118056952
N-[[(1R,3R)-3-[6-(2,6-difluorophenyl)pyridazin-4-yl]-1,2,2-trimethylcyclopentyl]methyl]-N-ethyl-3,3,3-trifluoropropane-1-sulfonamide (PubChem CID 118056952) has the molecular formula C24H30F5N3O2S and a molecular weight of 519.58 g/mol. Its IUPAC name is N-[[(1R,3R)-3-[6-(2,6-difluorophenyl)pyridazin-4-yl]-1,2,2-trimethylcyclopentyl]methyl]-N-ethyl-3,3,3-trifluoropropane-1-sulfonamide.
| Compound Name | N-[[(1R,3R)-3-[6-(2,6-difluorophenyl)pyridazin-4-yl]-1,2,2-trimethylcyclopentyl]methyl]-N-ethyl-3,3,3-trifluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 118056952 |
| Molecular Formula | C24H30F5N3O2S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | N-[[(1R,3R)-3-[6-(2,6-difluorophenyl)pyridazin-4-yl]-1,2,2-trimethylcyclopentyl]methyl]-N-ethyl-3,3,3-trifluoropropane-1-sulfonamide |
| SMILES | CCN(C[C@]1(C)CC[C@@H](c2cnnc(-c3c(F)cccc3F)c2)C1(C)C)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C24H30F5N3O2S/c1-5-32(35(33,34)12-11-24(27,28)29)15-23(4)10-9-17(22(23,2)3)16-13-20(31-30-14-16)21-18(25)7-6-8-19(21)26/h6-8,13-14,17H,5,9-12,15H2,1-4H3/t17-,23-/m0/s1 |
| InChIKey | WZQSRFQMCKYHEX-SBUREZEXSA-N |
| XLogP | 5.94 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |